C26H36N4O — CID 110141020
[(1S,2R,4R,9S,10R)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-(1-methyl-3-propan-2-ylpyrazol-5-yl)methanone (PubChem CID 110141020) has the molecular formula C26H36N4O and a molecular weight of 420.60 g/mol. Its IUPAC name is [(1S,2R,4R,9S,10R)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-(1-methyl-3-propan-2-ylpyrazol-5-yl)methanone.
| Compound Name | [(1S,2R,4R,9S,10R)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-(1-methyl-3-propan-2-ylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 110141020 |
| Molecular Formula | C26H36N4O |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | [(1S,2R,4R,9S,10R)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-(1-methyl-3-propan-2-ylpyrazol-5-yl)methanone |
| SMILES | CC(C)c1cc(C(=O)N2[C@H]3CCCC[C@H]4N[C@H](Cc5ccccc5)[C@@H]2C[C@@]34C)n(C)n1 |
| InChI | InChI=1S/C26H36N4O/c1-17(2)19-15-21(29(4)28-19)25(31)30-22-16-26(3)23(12-8-9-13-24(26)30)27-20(22)14-18-10-6-5-7-11-18/h5-7,10-11,15,17,20,22-24,27H,8-9,12-14,16H2,1-4H3/t20-,22+,23-,24+,26-/m1/s1 |
| InChIKey | IZNIPCFUFGPOPO-RNEGGKCOSA-N |
| XLogP | 4.29 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |