C26H31N5O2 — CID 110141082
[(1S,2R,4R,8S,9R)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-[3-(1-ethylpyrazol-4-yl)-1,2-oxazol-5-yl]methanone (PubChem CID 110141082) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is [(1S,2R,4R,8S,9R)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-[3-(1-ethylpyrazol-4-yl)-1,2-oxazol-5-yl]methanone.
| Compound Name | [(1S,2R,4R,8S,9R)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-[3-(1-ethylpyrazol-4-yl)-1,2-oxazol-5-yl]methanone |
|---|---|
| PubChem CID | 110141082 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | [(1S,2R,4R,8S,9R)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-[3-(1-ethylpyrazol-4-yl)-1,2-oxazol-5-yl]methanone |
| SMILES | CCn1cc(-c2cc(C(=O)N3[C@H]4CCC[C@H]5N[C@H](Cc6ccccc6)[C@@H]3C[C@@]45C)on2)cn1 |
| InChI | InChI=1S/C26H31N5O2/c1-3-30-16-18(15-27-30)19-13-22(33-29-19)25(32)31-21-14-26(2)23(10-7-11-24(26)31)28-20(21)12-17-8-5-4-6-9-17/h4-6,8-9,13,15-16,20-21,23-24,28H,3,7,10-12,14H2,1-2H3/t20-,21+,23-,24+,26-/m1/s1 |
| InChIKey | OXQCKHRKUVPVGC-LCTKTHOQSA-N |
| XLogP | 3.91 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |