C27H32N4O4 — CID 110141090
N-[2-[(1S,2R,4R,8S,9R)-3-acetyl-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-2-oxoethyl]-5-hydroxypyridine-3-carboxamide (PubChem CID 110141090) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is N-[2-[(1S,2R,4R,8S,9R)-3-acetyl-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-2-oxoethyl]-5-hydroxypyridine-3-carboxamide.
| Compound Name | N-[2-[(1S,2R,4R,8S,9R)-3-acetyl-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-2-oxoethyl]-5-hydroxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 110141090 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | N-[2-[(1S,2R,4R,8S,9R)-3-acetyl-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-2-oxoethyl]-5-hydroxypyridine-3-carboxamide |
| SMILES | CC(=O)N1[C@H](Cc2ccccc2)[C@@H]2C[C@@]3(C)[C@H](CCC[C@@H]13)N2C(=O)CNC(=O)c1cncc(O)c1 |
| InChI | InChI=1S/C27H32N4O4/c1-17(32)30-21(11-18-7-4-3-5-8-18)22-13-27(2)23(30)9-6-10-24(27)31(22)25(34)16-29-26(35)19-12-20(33)15-28-14-19/h3-5,7-8,12,14-15,21-24,33H,6,9-11,13,16H2,1-2H3,(H,29,35)/t21-,22+,23-,24+,27-/m1/s1 |
| InChIKey | ONJKLKCTIBJECL-KLWMKENUSA-N |
| XLogP | 2.52 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |