C18H28N4O — CID 110141166
(5-butyl-1H-pyrazol-3-yl)-[(1S,4R,8S,9S)-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]methanone (PubChem CID 110141166) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is (5-butyl-1H-pyrazol-3-yl)-[(1S,4R,8S,9S)-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]methanone.
| Compound Name | (5-butyl-1H-pyrazol-3-yl)-[(1S,4R,8S,9S)-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]methanone |
|---|---|
| PubChem CID | 110141166 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | (5-butyl-1H-pyrazol-3-yl)-[(1S,4R,8S,9S)-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]methanone |
| SMILES | CCCCc1cc(C(=O)N2C[C@@H]3C[C@@]4(C)[C@H](CCC[C@@H]24)N3)n[nH]1 |
| InChI | InChI=1S/C18H28N4O/c1-3-4-6-12-9-14(21-20-12)17(23)22-11-13-10-18(2)15(19-13)7-5-8-16(18)22/h9,13,15-16,19H,3-8,10-11H2,1-2H3,(H,20,21)/t13-,15-,16+,18-/m0/s1 |
| InChIKey | ZKSCEOUAJUDJAQ-SCNOPHJPSA-N |
| XLogP | 2.50 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |