C26H34N4O4 — CID 110141321
1-[(1S,4R,9S,10R)-3-[3-(2,5-dimethoxyphenyl)-4-methyl-1H-pyrazole-5-carbonyl]-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]ethanone (PubChem CID 110141321) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 1-[(1S,4R,9S,10R)-3-[3-(2,5-dimethoxyphenyl)-4-methyl-1H-pyrazole-5-carbonyl]-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]ethanone.
| Compound Name | 1-[(1S,4R,9S,10R)-3-[3-(2,5-dimethoxyphenyl)-4-methyl-1H-pyrazole-5-carbonyl]-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]ethanone |
|---|---|
| PubChem CID | 110141321 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 1-[(1S,4R,9S,10R)-3-[3-(2,5-dimethoxyphenyl)-4-methyl-1H-pyrazole-5-carbonyl]-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]ethanone |
| SMILES | COc1ccc(OC)c(-c2n[nH]c(C(=O)N3C[C@@H]4C[C@@]5(C)[C@H](CCCC[C@@H]35)N4C(C)=O)c2C)c1 |
| InChI | InChI=1S/C26H34N4O4/c1-15-23(19-12-18(33-4)10-11-20(19)34-5)27-28-24(15)25(32)29-14-17-13-26(3)21(29)8-6-7-9-22(26)30(17)16(2)31/h10-12,17,21-22H,6-9,13-14H2,1-5H3,(H,27,28)/t17-,21+,22-,26+/m0/s1 |
| InChIKey | SWTBFFOVDRCCJY-OFCWLIIESA-N |
| XLogP | 3.80 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |