C23H33NO3 — CID 11014146
3,3-dimethyl-1-[(2S)-2-(6-phenylhexanoyl)piperidin-1-yl]butane-1,2-dione (PubChem CID 11014146) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(2S)-2-(6-phenylhexanoyl)piperidin-1-yl]butane-1,2-dione.
| Compound Name | 3,3-dimethyl-1-[(2S)-2-(6-phenylhexanoyl)piperidin-1-yl]butane-1,2-dione |
|---|---|
| PubChem CID | 11014146 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 3,3-dimethyl-1-[(2S)-2-(6-phenylhexanoyl)piperidin-1-yl]butane-1,2-dione |
| SMILES | CC(C)(C)C(=O)C(=O)N1CCCC[C@H]1C(=O)CCCCCc1ccccc1 |
| InChI | InChI=1S/C23H33NO3/c1-23(2,3)21(26)22(27)24-17-11-10-15-19(24)20(25)16-9-5-8-14-18-12-6-4-7-13-18/h4,6-7,12-13,19H,5,8-11,14-17H2,1-3H3/t19-/m0/s1 |
| InChIKey | KXRWORMMOREIQT-IBGZPJMESA-N |
| XLogP | 4.35 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|