C23H28N4O2S — CID 110141553
1-[(1S,4R,9S,10R)-10-methyl-3-(4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl)-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]ethanone (PubChem CID 110141553) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is 1-[(1S,4R,9S,10R)-10-methyl-3-(4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl)-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]ethanone.
| Compound Name | 1-[(1S,4R,9S,10R)-10-methyl-3-(4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl)-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]ethanone |
|---|---|
| PubChem CID | 110141553 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1-[(1S,4R,9S,10R)-10-methyl-3-(4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl)-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]ethanone |
| SMILES | CC(=O)N1[C@@H]2CN(C(=O)c3sc(-c4cccnc4)nc3C)[C@@H]3CCCC[C@H]1[C@]3(C)C2 |
| InChI | InChI=1S/C23H28N4O2S/c1-14-20(30-21(25-14)16-7-6-10-24-12-16)22(29)26-13-17-11-23(3)18(26)8-4-5-9-19(23)27(17)15(2)28/h6-7,10,12,17-19H,4-5,8-9,11,13H2,1-3H3/t17-,18+,19-,23+/m0/s1 |
| InChIKey | GQAUORFSVYENQR-QPXQOZNCSA-N |
| XLogP | 3.91 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |