C18H26N4O2 — CID 110141692
4-[(1S,4R,9S,10R)-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecane-12-carbonyl]-6-methyl-1H-pyrimidin-2-one (PubChem CID 110141692) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 4-[(1S,4R,9S,10R)-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecane-12-carbonyl]-6-methyl-1H-pyrimidin-2-one.
| Compound Name | 4-[(1S,4R,9S,10R)-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecane-12-carbonyl]-6-methyl-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 110141692 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 4-[(1S,4R,9S,10R)-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecane-12-carbonyl]-6-methyl-1H-pyrimidin-2-one |
| SMILES | Cc1cc(C(=O)N2[C@@H]3CN(C)[C@@H]4CCCC[C@H]2[C@]4(C)C3)nc(=O)[nH]1 |
| InChI | InChI=1S/C18H26N4O2/c1-11-8-13(20-17(24)19-11)16(23)22-12-9-18(2)14(21(3)10-12)6-4-5-7-15(18)22/h8,12,14-15H,4-7,9-10H2,1-3H3,(H,19,20,24)/t12-,14+,15-,18+/m0/s1 |
| InChIKey | LWWVAPMKKMFZCB-WLLUSJSYSA-N |
| XLogP | 1.56 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |