C15H21N3OS — CID 110141748
[(1S,4R,8S,9S)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-(1,3-thiazol-5-yl)methanone (PubChem CID 110141748) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is [(1S,4R,8S,9S)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-(1,3-thiazol-5-yl)methanone.
| Compound Name | [(1S,4R,8S,9S)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-(1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 110141748 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | [(1S,4R,8S,9S)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-(1,3-thiazol-5-yl)methanone |
| SMILES | CN1[C@@H]2CN(C(=O)c3cncs3)[C@@H]3CCC[C@H]1[C@]3(C)C2 |
| InChI | InChI=1S/C15H21N3OS/c1-15-6-10-8-18(14(19)11-7-16-9-20-11)13(15)5-3-4-12(15)17(10)2/h7,9-10,12-13H,3-6,8H2,1-2H3/t10-,12-,13+,15-/m0/s1 |
| InChIKey | HDXUXXUWVXJKFL-DNVSUFBTSA-N |
| XLogP | 2.23 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |