C18H27N3OS — CID 110141825
1-[(1S,4R,8S,9S)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone (PubChem CID 110141825) has the molecular formula C18H27N3OS and a molecular weight of 333.50 g/mol. Its IUPAC name is 1-[(1S,4R,8S,9S)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-[(1S,4R,8S,9S)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 110141825 |
| Molecular Formula | C18H27N3OS |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 1-[(1S,4R,8S,9S)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone |
| SMILES | Cc1nc(C)c(CC(=O)N2C[C@@H]3C[C@@]4(C)[C@H](CCC[C@@H]24)N3C)s1 |
| InChI | InChI=1S/C18H27N3OS/c1-11-14(23-12(2)19-11)8-17(22)21-10-13-9-18(3)15(20(13)4)6-5-7-16(18)21/h13,15-16H,5-10H2,1-4H3/t13-,15-,16+,18-/m0/s1 |
| InChIKey | RSAAXYGALJDAIG-SCNOPHJPSA-N |
| XLogP | 2.78 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |