C20H28N2O3 — CID 110141830
2-[2-[[(1S,4R,8S,9R)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]methyl]phenoxy]acetic acid (PubChem CID 110141830) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is 2-[2-[[(1S,4R,8S,9R)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[[(1S,4R,8S,9R)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 110141830 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 2-[2-[[(1S,4R,8S,9R)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]methyl]phenoxy]acetic acid |
| SMILES | CN1[C@@H]2CN(Cc3ccccc3OCC(=O)O)[C@@H]3CCC[C@H]1[C@]3(C)C2 |
| InChI | InChI=1S/C20H28N2O3/c1-20-10-15-12-22(18(20)9-5-8-17(20)21(15)2)11-14-6-3-4-7-16(14)25-13-19(23)24/h3-4,6-7,15,17-18H,5,8-13H2,1-2H3,(H,23,24)/t15-,17-,18+,20-/m0/s1 |
| InChIKey | JZGFNANTNNGTEF-BOLBYERCSA-N |
| XLogP | 2.60 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |