C18H24N4O2 — CID 110141890
1-[(1S,4R,8S,9R)-9-methyl-11-(5-methylpyrazine-2-carbonyl)-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]ethanone (PubChem CID 110141890) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 1-[(1S,4R,8S,9R)-9-methyl-11-(5-methylpyrazine-2-carbonyl)-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]ethanone.
| Compound Name | 1-[(1S,4R,8S,9R)-9-methyl-11-(5-methylpyrazine-2-carbonyl)-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]ethanone |
|---|---|
| PubChem CID | 110141890 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 1-[(1S,4R,8S,9R)-9-methyl-11-(5-methylpyrazine-2-carbonyl)-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]ethanone |
| SMILES | CC(=O)N1C[C@@H]2C[C@@]3(C)[C@H](CCC[C@@H]13)N2C(=O)c1cnc(C)cn1 |
| InChI | InChI=1S/C18H24N4O2/c1-11-8-20-14(9-19-11)17(24)22-13-7-18(3)15(5-4-6-16(18)22)21(10-13)12(2)23/h8-9,13,15-16H,4-7,10H2,1-3H3/t13-,15+,16-,18+/m0/s1 |
| InChIKey | IBMORRCVGDEALM-JXSMBQFASA-N |
| XLogP | 1.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |