C22H19FN4O — CID 11014215
12-benzyl-4-(3-fluorophenyl)-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one (PubChem CID 11014215) has the molecular formula C22H19FN4O and a molecular weight of 374.42 g/mol. Its IUPAC name is 12-benzyl-4-(3-fluorophenyl)-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one.
| Compound Name | 12-benzyl-4-(3-fluorophenyl)-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one |
|---|---|
| PubChem CID | 11014215 |
| Molecular Formula | C22H19FN4O |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 12-benzyl-4-(3-fluorophenyl)-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one |
| SMILES | O=c1[nH]c2c(c3nc(-c4cccc(F)c4)cn13)CN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C22H19FN4O/c23-17-8-4-7-16(11-17)20-14-27-21(24-20)18-13-26(10-9-19(18)25-22(27)28)12-15-5-2-1-3-6-15/h1-8,11,14H,9-10,12-13H2,(H,25,28) |
| InChIKey | PCILNHKPPMAMLQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |