C22H33NO3 — CID 110142451
N-[(2R,4R,4aS,7R,8aR)-2-(3-hydroxyphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methylbutanamide (PubChem CID 110142451) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is N-[(2R,4R,4aS,7R,8aR)-2-(3-hydroxyphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methylbutanamide.
| Compound Name | N-[(2R,4R,4aS,7R,8aR)-2-(3-hydroxyphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 110142451 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | N-[(2R,4R,4aS,7R,8aR)-2-(3-hydroxyphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)N[C@]1(C)C[C@H](c2cccc(O)c2)O[C@@H]2C[C@H](C)CC[C@H]21 |
| InChI | InChI=1S/C22H33NO3/c1-14(2)10-21(25)23-22(4)13-20(16-6-5-7-17(24)12-16)26-19-11-15(3)8-9-18(19)22/h5-7,12,14-15,18-20,24H,8-11,13H2,1-4H3,(H,23,25)/t15-,18-,19-,20-,22-/m1/s1 |
| InChIKey | IILKMYPBXYHJJN-YCSCGVHMSA-N |
| XLogP | 4.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |