C23H30N2O3S — CID 110142613
(4aS,10bS)-7-methoxy-5,5-dimethyl-1'-(1,3-thiazol-4-ylmethyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine] (PubChem CID 110142613) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is (4aS,10bS)-7-methoxy-5,5-dimethyl-1'-(1,3-thiazol-4-ylmethyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine].
| Compound Name | (4aS,10bS)-7-methoxy-5,5-dimethyl-1'-(1,3-thiazol-4-ylmethyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine] |
|---|---|
| PubChem CID | 110142613 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (4aS,10bS)-7-methoxy-5,5-dimethyl-1'-(1,3-thiazol-4-ylmethyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine] |
| SMILES | COc1cccc2c1OC(C)(C)[C@H]1CC3(CCN(Cc4cscn4)CC3)CO[C@H]21 |
| InChI | InChI=1S/C23H30N2O3S/c1-22(2)18-11-23(7-9-25(10-8-23)12-16-13-29-15-24-16)14-27-20(18)17-5-4-6-19(26-3)21(17)28-22/h4-6,13,15,18,20H,7-12,14H2,1-3H3/t18-,20+/m0/s1 |
| InChIKey | ZQDRNHUJURSIOV-AZUAARDMSA-N |
| XLogP | 4.68 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |