C24H32N2O3S — CID 110142678
(4aS,10bS)-9-methoxy-5,5-dimethyl-1'-[(4-methyl-1,3-thiazol-5-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine] (PubChem CID 110142678) has the molecular formula C24H32N2O3S and a molecular weight of 428.60 g/mol. Its IUPAC name is (4aS,10bS)-9-methoxy-5,5-dimethyl-1'-[(4-methyl-1,3-thiazol-5-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine].
| Compound Name | (4aS,10bS)-9-methoxy-5,5-dimethyl-1'-[(4-methyl-1,3-thiazol-5-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine] |
|---|---|
| PubChem CID | 110142678 |
| Molecular Formula | C24H32N2O3S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (4aS,10bS)-9-methoxy-5,5-dimethyl-1'-[(4-methyl-1,3-thiazol-5-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine] |
| SMILES | COc1ccc2c(c1)[C@H]1OCC3(CCN(Cc4scnc4C)CC3)C[C@@H]1C(C)(C)O2 |
| InChI | InChI=1S/C24H32N2O3S/c1-16-21(30-15-25-16)13-26-9-7-24(8-10-26)12-19-22(28-14-24)18-11-17(27-4)5-6-20(18)29-23(19,2)3/h5-6,11,15,19,22H,7-10,12-14H2,1-4H3/t19-,22+/m0/s1 |
| InChIKey | ZMDYQTPWQOJBKD-SIKLNZKXSA-N |
| XLogP | 4.99 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |