C24H32ClNO4 — CID 110142681
[(4aS,10bS)-9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(oxan-4-yl)methanone (PubChem CID 110142681) has the molecular formula C24H32ClNO4 and a molecular weight of 433.98 g/mol. Its IUPAC name is [(4aS,10bS)-9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(oxan-4-yl)methanone.
| Compound Name | [(4aS,10bS)-9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 110142681 |
| Molecular Formula | C24H32ClNO4 |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | [(4aS,10bS)-9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(oxan-4-yl)methanone |
| SMILES | CC1(C)Oc2ccc(Cl)cc2[C@H]2OCC3(CCN(C(=O)C4CCOCC4)CC3)C[C@@H]21 |
| InChI | InChI=1S/C24H32ClNO4/c1-23(2)19-14-24(15-29-21(19)18-13-17(25)3-4-20(18)30-23)7-9-26(10-8-24)22(27)16-5-11-28-12-6-16/h3-4,13,16,19,21H,5-12,14-15H2,1-2H3/t19-,21+/m0/s1 |
| InChIKey | XHXJJEAAZSSTBD-PZJWPPBQSA-N |
| XLogP | 4.62 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |