C24H27ClN2O4 — CID 110142707
3-[(4aS,10bS)-9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-carbonyl]-1H-pyridin-2-one (PubChem CID 110142707) has the molecular formula C24H27ClN2O4 and a molecular weight of 442.94 g/mol. Its IUPAC name is 3-[(4aS,10bS)-9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-carbonyl]-1H-pyridin-2-one.
| Compound Name | 3-[(4aS,10bS)-9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 110142707 |
| Molecular Formula | C24H27ClN2O4 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 3-[(4aS,10bS)-9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-carbonyl]-1H-pyridin-2-one |
| SMILES | CC1(C)Oc2ccc(Cl)cc2[C@H]2OCC3(CCN(C(=O)c4ccc[nH]c4=O)CC3)C[C@@H]21 |
| InChI | InChI=1S/C24H27ClN2O4/c1-23(2)18-13-24(14-30-20(18)17-12-15(25)5-6-19(17)31-23)7-10-27(11-8-24)22(29)16-4-3-9-26-21(16)28/h3-6,9,12,18,20H,7-8,10-11,13-14H2,1-2H3,(H,26,28)/t18-,20+/m0/s1 |
| InChIKey | HQUFWZGJAJNERN-AZUAARDMSA-N |
| XLogP | 4.20 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |