C25H36N2O3 — CID 110142747
1-[(4aS,10bS)-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-3-pyrrolidin-1-ylpropan-1-one (PubChem CID 110142747) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is 1-[(4aS,10bS)-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-3-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 1-[(4aS,10bS)-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-3-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 110142747 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | 1-[(4aS,10bS)-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-3-pyrrolidin-1-ylpropan-1-one |
| SMILES | CC1(C)Oc2ccccc2[C@H]2OCC3(CCN(C(=O)CCN4CCCC4)CC3)C[C@@H]21 |
| InChI | InChI=1S/C25H36N2O3/c1-24(2)20-17-25(18-29-23(20)19-7-3-4-8-21(19)30-24)10-15-27(16-11-25)22(28)9-14-26-12-5-6-13-26/h3-4,7-8,20,23H,5-6,9-18H2,1-2H3/t20-,23+/m0/s1 |
| InChIKey | MIQICECORASVHO-NZQKXSOJSA-N |
| XLogP | 4.03 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |