C25H35ClN2O3 — CID 110142755
[(4aS,10bS)-9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(1-methylpiperidin-4-yl)methanone (PubChem CID 110142755) has the molecular formula C25H35ClN2O3 and a molecular weight of 447.02 g/mol. Its IUPAC name is [(4aS,10bS)-9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(1-methylpiperidin-4-yl)methanone.
| Compound Name | [(4aS,10bS)-9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(1-methylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 110142755 |
| Molecular Formula | C25H35ClN2O3 |
| Molecular Weight | 447.02 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | [(4aS,10bS)-9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(1-methylpiperidin-4-yl)methanone |
| SMILES | CN1CCC(C(=O)N2CCC3(CC2)CO[C@@H]2c4cc(Cl)ccc4OC(C)(C)[C@H]2C3)CC1 |
| InChI | InChI=1S/C25H35ClN2O3/c1-24(2)20-15-25(16-30-22(20)19-14-18(26)4-5-21(19)31-24)8-12-28(13-9-25)23(29)17-6-10-27(3)11-7-17/h4-5,14,17,20,22H,6-13,15-16H2,1-3H3/t20-,22+/m0/s1 |
| InChIKey | ZOLYDXHCMNZXJY-RBBKRZOGSA-N |
| XLogP | 4.54 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.02 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |