C25H28N4O3 — CID 110142799
[(4aS,10bS)-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(2H-benzotriazol-5-yl)methanone (PubChem CID 110142799) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is [(4aS,10bS)-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(2H-benzotriazol-5-yl)methanone.
| Compound Name | [(4aS,10bS)-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(2H-benzotriazol-5-yl)methanone |
|---|---|
| PubChem CID | 110142799 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | [(4aS,10bS)-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(2H-benzotriazol-5-yl)methanone |
| SMILES | CC1(C)Oc2ccccc2[C@H]2OCC3(CCN(C(=O)c4ccc5n[nH]nc5c4)CC3)C[C@@H]21 |
| InChI | InChI=1S/C25H28N4O3/c1-24(2)18-14-25(15-31-22(18)17-5-3-4-6-21(17)32-24)9-11-29(12-10-25)23(30)16-7-8-19-20(13-16)27-28-26-19/h3-8,13,18,22H,9-12,14-15H2,1-2H3,(H,26,27,28)/t18-,22+/m0/s1 |
| InChIKey | VOWYIUCDOGWXGM-PGRDOPGGSA-N |
| XLogP | 4.13 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |