C25H44O2 — CID 11014292
2-[(2E,6E,11S)-3,7,11,15-tetramethylhexadeca-2,6,14-trienoxy]oxane (PubChem CID 11014292) has the molecular formula C25H44O2 and a molecular weight of 376.63 g/mol. Its IUPAC name is 2-[(2E,6E,11S)-3,7,11,15-tetramethylhexadeca-2,6,14-trienoxy]oxane.
| Compound Name | 2-[(2E,6E,11S)-3,7,11,15-tetramethylhexadeca-2,6,14-trienoxy]oxane |
|---|---|
| PubChem CID | 11014292 |
| Molecular Formula | C25H44O2 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.33 |
| IUPAC Name | 2-[(2E,6E,11S)-3,7,11,15-tetramethylhexadeca-2,6,14-trienoxy]oxane |
| SMILES | CC(C)=CCC[C@@H](C)CCC/C(C)=C/CC/C(C)=C/COC1CCCCO1 |
| InChI | InChI=1S/C25H44O2/c1-21(2)11-8-12-22(3)13-9-14-23(4)15-10-16-24(5)18-20-27-25-17-6-7-19-26-25/h11,15,18,22,25H,6-10,12-14,16-17,19-20H2,1-5H3/b23-15+,24-18+/t22-,25?/m1/s1 |
| InChIKey | CWNUUOKFWZEPGH-VXZNFPPPSA-N |
| XLogP | 7.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|