C18H25N3O2 — CID 110143074
[(1S,3S,7S,10S,11R)-11-hydroxy-1,12-dimethyl-5,12-diazatricyclo[5.3.1.13,10]dodecan-5-yl]-pyridin-4-ylmethanone (PubChem CID 110143074) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is [(1S,3S,7S,10S,11R)-11-hydroxy-1,12-dimethyl-5,12-diazatricyclo[5.3.1.13,10]dodecan-5-yl]-pyridin-4-ylmethanone.
| Compound Name | [(1S,3S,7S,10S,11R)-11-hydroxy-1,12-dimethyl-5,12-diazatricyclo[5.3.1.13,10]dodecan-5-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 110143074 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | [(1S,3S,7S,10S,11R)-11-hydroxy-1,12-dimethyl-5,12-diazatricyclo[5.3.1.13,10]dodecan-5-yl]-pyridin-4-ylmethanone |
| SMILES | CN1[C@@H]2CN(C(=O)c3ccncc3)C[C@@H]3CC[C@H]1[C@](C)(C2)[C@@H]3O |
| InChI | InChI=1S/C18H25N3O2/c1-18-9-14-11-21(17(23)12-5-7-19-8-6-12)10-13(16(18)22)3-4-15(18)20(14)2/h5-8,13-16,22H,3-4,9-11H2,1-2H3/t13-,14-,15-,16+,18-/m0/s1 |
| InChIKey | BFLFKRLWHZXEKL-FDPKGLCPSA-N |
| XLogP | 1.39 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |