C20H26N4O2 — CID 110143096
1-[(3R,3aS,4R,8aS)-4-hydroxy-1-methyl-3-phenyl-2,3,3a,4,5,6,8,8a-octahydropyrrolo[2,3-c]azepin-7-yl]-2-imidazol-1-ylethanone (PubChem CID 110143096) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[(3R,3aS,4R,8aS)-4-hydroxy-1-methyl-3-phenyl-2,3,3a,4,5,6,8,8a-octahydropyrrolo[2,3-c]azepin-7-yl]-2-imidazol-1-ylethanone.
| Compound Name | 1-[(3R,3aS,4R,8aS)-4-hydroxy-1-methyl-3-phenyl-2,3,3a,4,5,6,8,8a-octahydropyrrolo[2,3-c]azepin-7-yl]-2-imidazol-1-ylethanone |
|---|---|
| PubChem CID | 110143096 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 1-[(3R,3aS,4R,8aS)-4-hydroxy-1-methyl-3-phenyl-2,3,3a,4,5,6,8,8a-octahydropyrrolo[2,3-c]azepin-7-yl]-2-imidazol-1-ylethanone |
| SMILES | CN1C[C@@H](c2ccccc2)[C@@H]2[C@H](O)CCN(C(=O)Cn3ccnc3)C[C@H]21 |
| InChI | InChI=1S/C20H26N4O2/c1-22-11-16(15-5-3-2-4-6-15)20-17(22)12-24(9-7-18(20)25)19(26)13-23-10-8-21-14-23/h2-6,8,10,14,16-18,20,25H,7,9,11-13H2,1H3/t16-,17+,18+,20-/m0/s1 |
| InChIKey | CPFJZHCLOFEFPX-XFKSJGNHSA-N |
| XLogP | 1.19 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |