C17H24N4O4 — CID 110143190
1-[2-[(1S,3S,7S,10S,11R)-11-hydroxy-1-methyl-5,12-diazatricyclo[5.3.1.13,10]dodecan-5-yl]-2-oxoethyl]pyrimidine-2,4-dione (PubChem CID 110143190) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-[2-[(1S,3S,7S,10S,11R)-11-hydroxy-1-methyl-5,12-diazatricyclo[5.3.1.13,10]dodecan-5-yl]-2-oxoethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-[(1S,3S,7S,10S,11R)-11-hydroxy-1-methyl-5,12-diazatricyclo[5.3.1.13,10]dodecan-5-yl]-2-oxoethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 110143190 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[2-[(1S,3S,7S,10S,11R)-11-hydroxy-1-methyl-5,12-diazatricyclo[5.3.1.13,10]dodecan-5-yl]-2-oxoethyl]pyrimidine-2,4-dione |
| SMILES | C[C@]12C[C@H]3CN(C(=O)Cn4ccc(=O)[nH]c4=O)C[C@H](CC[C@@H]1N3)[C@H]2O |
| InChI | InChI=1S/C17H24N4O4/c1-17-6-11-8-21(7-10(15(17)24)2-3-12(17)18-11)14(23)9-20-5-4-13(22)19-16(20)25/h4-5,10-12,15,18,24H,2-3,6-9H2,1H3,(H,19,22,25)/t10-,11-,12-,15+,17-/m0/s1 |
| InChIKey | VMCBZSDCKTZHQV-ZAZMCIGGSA-N |
| XLogP | -1.11 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |