C21H26N2O3S — CID 110143345
(4aS,10bS)-7-methoxy-5,5-dimethyl-1'-(1,3-thiazol-5-ylmethyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine] (PubChem CID 110143345) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is (4aS,10bS)-7-methoxy-5,5-dimethyl-1'-(1,3-thiazol-5-ylmethyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine].
| Compound Name | (4aS,10bS)-7-methoxy-5,5-dimethyl-1'-(1,3-thiazol-5-ylmethyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine] |
|---|---|
| PubChem CID | 110143345 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (4aS,10bS)-7-methoxy-5,5-dimethyl-1'-(1,3-thiazol-5-ylmethyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine] |
| SMILES | COc1cccc2c1OC(C)(C)[C@H]1CC3(CO[C@H]21)CN(Cc1cncs1)C3 |
| InChI | InChI=1S/C21H26N2O3S/c1-20(2)16-7-21(10-23(11-21)9-14-8-22-13-27-14)12-25-18(16)15-5-4-6-17(24-3)19(15)26-20/h4-6,8,13,16,18H,7,9-12H2,1-3H3/t16-,18+/m0/s1 |
| InChIKey | XYIBALSSVKXAJA-FUHWJXTLSA-N |
| XLogP | 3.90 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |