C22H28N2O3S — CID 110143366
(4aS,10bS)-7-methoxy-5,5-dimethyl-1'-[(4-methyl-1,3-thiazol-5-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine] (PubChem CID 110143366) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is (4aS,10bS)-7-methoxy-5,5-dimethyl-1'-[(4-methyl-1,3-thiazol-5-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine].
| Compound Name | (4aS,10bS)-7-methoxy-5,5-dimethyl-1'-[(4-methyl-1,3-thiazol-5-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine] |
|---|---|
| PubChem CID | 110143366 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | (4aS,10bS)-7-methoxy-5,5-dimethyl-1'-[(4-methyl-1,3-thiazol-5-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine] |
| SMILES | COc1cccc2c1OC(C)(C)[C@H]1CC3(CO[C@H]21)CN(Cc1scnc1C)C3 |
| InChI | InChI=1S/C22H28N2O3S/c1-14-18(28-13-23-14)9-24-10-22(11-24)8-16-19(26-12-22)15-6-5-7-17(25-4)20(15)27-21(16,2)3/h5-7,13,16,19H,8-12H2,1-4H3/t16-,19+/m0/s1 |
| InChIKey | FIJUPYIURDUITO-QFBILLFUSA-N |
| XLogP | 4.21 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |