C25H32N4O3 — CID 110143408
1-[(4aS,10bS)-5,5,8-trimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine]-1'-yl]-4-(pyrimidin-2-ylamino)butan-1-one (PubChem CID 110143408) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is 1-[(4aS,10bS)-5,5,8-trimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine]-1'-yl]-4-(pyrimidin-2-ylamino)butan-1-one.
| Compound Name | 1-[(4aS,10bS)-5,5,8-trimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine]-1'-yl]-4-(pyrimidin-2-ylamino)butan-1-one |
|---|---|
| PubChem CID | 110143408 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 1-[(4aS,10bS)-5,5,8-trimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine]-1'-yl]-4-(pyrimidin-2-ylamino)butan-1-one |
| SMILES | Cc1ccc2c(c1)OC(C)(C)[C@H]1CC3(CO[C@H]21)CN(C(=O)CCCNc1ncccn1)C3 |
| InChI | InChI=1S/C25H32N4O3/c1-17-7-8-18-20(12-17)32-24(2,3)19-13-25(16-31-22(18)19)14-29(15-25)21(30)6-4-9-26-23-27-10-5-11-28-23/h5,7-8,10-12,19,22H,4,6,9,13-16H2,1-3H3,(H,26,27,28)/t19-,22+/m0/s1 |
| InChIKey | DZGHDVPCZNTIJC-SIKLNZKXSA-N |
| XLogP | 3.75 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|