C22H31N3O3 — CID 110143485
N-[2-[(5R,6S,8R,10S)-10-acetamido-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-5-yl]ethyl]pyridine-2-carboxamide (PubChem CID 110143485) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[2-[(5R,6S,8R,10S)-10-acetamido-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-5-yl]ethyl]pyridine-2-carboxamide.
| Compound Name | N-[2-[(5R,6S,8R,10S)-10-acetamido-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-5-yl]ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 110143485 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N-[2-[(5R,6S,8R,10S)-10-acetamido-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-5-yl]ethyl]pyridine-2-carboxamide |
| SMILES | CC(=O)N[C@H]1C(C)(C)[C@@H]2C[C@@H]3[C@@H](CCNC(=O)c4ccccn4)OCCC31C2 |
| InChI | InChI=1S/C22H31N3O3/c1-14(26)25-20-21(2,3)15-12-16-18(28-11-8-22(16,20)13-15)7-10-24-19(27)17-6-4-5-9-23-17/h4-6,9,15-16,18,20H,7-8,10-13H2,1-3H3,(H,24,27)(H,25,26)/t15-,16-,18-,20+,22?/m1/s1 |
| InChIKey | KXGZNKHRRAOPTQ-VJSVJUHHSA-N |
| XLogP | 2.55 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |