C19H27FN2O2 — CID 110143646
1-[(2R,3aR,4R,8aR)-2-(aminomethyl)-4-hydroxy-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-2-(4-fluorophenyl)ethanone (PubChem CID 110143646) has the molecular formula C19H27FN2O2 and a molecular weight of 334.44 g/mol. Its IUPAC name is 1-[(2R,3aR,4R,8aR)-2-(aminomethyl)-4-hydroxy-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-[(2R,3aR,4R,8aR)-2-(aminomethyl)-4-hydroxy-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 110143646 |
| Molecular Formula | C19H27FN2O2 |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 1-[(2R,3aR,4R,8aR)-2-(aminomethyl)-4-hydroxy-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-2-(4-fluorophenyl)ethanone |
| SMILES | C[C@@]12C[C@H](CN)N(C(=O)Cc3ccc(F)cc3)[C@@H]1CCCC[C@H]2O |
| InChI | InChI=1S/C19H27FN2O2/c1-19-11-15(12-21)22(16(19)4-2-3-5-17(19)23)18(24)10-13-6-8-14(20)9-7-13/h6-9,15-17,23H,2-5,10-12,21H2,1H3/t15-,16-,17-,19-/m1/s1 |
| InChIKey | OYXQOCXEBXTOHM-YWTNHNAXSA-N |
| XLogP | 2.24 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |