C20H29NO2 — CID 110143804
N-[(4R,4aS,7R,8aR)-4,7-dimethyl-2-(4-methylphenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide (PubChem CID 110143804) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is N-[(4R,4aS,7R,8aR)-4,7-dimethyl-2-(4-methylphenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide.
| Compound Name | N-[(4R,4aS,7R,8aR)-4,7-dimethyl-2-(4-methylphenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide |
|---|---|
| PubChem CID | 110143804 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | N-[(4R,4aS,7R,8aR)-4,7-dimethyl-2-(4-methylphenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide |
| SMILES | CC(=O)N[C@]1(C)CC(c2ccc(C)cc2)O[C@@H]2C[C@H](C)CC[C@H]21 |
| InChI | InChI=1S/C20H29NO2/c1-13-5-8-16(9-6-13)19-12-20(4,21-15(3)22)17-10-7-14(2)11-18(17)23-19/h5-6,8-9,14,17-19H,7,10-12H2,1-4H3,(H,21,22)/t14-,17-,18-,19?,20-/m1/s1 |
| InChIKey | IGMXGKAICVPBDO-AOGNXIRESA-N |
| XLogP | 4.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |