C21H26N2O2S — CID 110143982
(4aS,10bS)-8-methyl-1'-(1,3-thiazol-4-ylmethyl)spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine] (PubChem CID 110143982) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is (4aS,10bS)-8-methyl-1'-(1,3-thiazol-4-ylmethyl)spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine].
| Compound Name | (4aS,10bS)-8-methyl-1'-(1,3-thiazol-4-ylmethyl)spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine] |
|---|---|
| PubChem CID | 110143982 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (4aS,10bS)-8-methyl-1'-(1,3-thiazol-4-ylmethyl)spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine] |
| SMILES | Cc1ccc2c(c1)OC1(CCN(Cc3cscn3)CC1)[C@H]1CCCO[C@H]21 |
| InChI | InChI=1S/C21H26N2O2S/c1-15-4-5-17-19(11-15)25-21(18-3-2-10-24-20(17)18)6-8-23(9-7-21)12-16-13-26-14-22-16/h4-5,11,13-14,18,20H,2-3,6-10,12H2,1H3/t18-,20+/m0/s1 |
| InChIKey | LRZYJLIBAMCLDE-AZUAARDMSA-N |
| XLogP | 4.35 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |