C20H24N2O3S — CID 110143989
(4aS,10bS)-1'-(1,3-thiazol-5-ylmethyl)spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-7-ol (PubChem CID 110143989) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is (4aS,10bS)-1'-(1,3-thiazol-5-ylmethyl)spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-7-ol.
| Compound Name | (4aS,10bS)-1'-(1,3-thiazol-5-ylmethyl)spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-7-ol |
|---|---|
| PubChem CID | 110143989 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (4aS,10bS)-1'-(1,3-thiazol-5-ylmethyl)spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-7-ol |
| SMILES | Oc1cccc2c1OC1(CCN(Cc3cncs3)CC1)[C@H]1CCCO[C@H]21 |
| InChI | InChI=1S/C20H24N2O3S/c23-17-5-1-3-15-18-16(4-2-10-24-18)20(25-19(15)17)6-8-22(9-7-20)12-14-11-21-13-26-14/h1,3,5,11,13,16,18,23H,2,4,6-10,12H2/t16-,18+/m0/s1 |
| InChIKey | IRCLUNWCOVJOTL-FUHWJXTLSA-N |
| XLogP | 3.74 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |