C24H26ClNO4 — CID 110144098
4-[[(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]methyl]benzoic acid (PubChem CID 110144098) has the molecular formula C24H26ClNO4 and a molecular weight of 427.93 g/mol. Its IUPAC name is 4-[[(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]methyl]benzoic acid.
| Compound Name | 4-[[(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 110144098 |
| Molecular Formula | C24H26ClNO4 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 4-[[(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN2CCC3(CC2)Oc2ccc(Cl)cc2[C@H]2OCCC[C@@H]23)cc1 |
| InChI | InChI=1S/C24H26ClNO4/c25-18-7-8-21-19(14-18)22-20(2-1-13-29-22)24(30-21)9-11-26(12-10-24)15-16-3-5-17(6-4-16)23(27)28/h3-8,14,20,22H,1-2,9-13,15H2,(H,27,28)/t20-,22+/m0/s1 |
| InChIKey | SLQPUPWFXHZYNB-RBBKRZOGSA-N |
| XLogP | 4.93 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |