C23H29F2NO4 — CID 110144125
[(4aS,10bS)-7-hydroxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(4,4-difluorocyclohexyl)methanone (PubChem CID 110144125) has the molecular formula C23H29F2NO4 and a molecular weight of 421.48 g/mol. Its IUPAC name is [(4aS,10bS)-7-hydroxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(4,4-difluorocyclohexyl)methanone.
| Compound Name | [(4aS,10bS)-7-hydroxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(4,4-difluorocyclohexyl)methanone |
|---|---|
| PubChem CID | 110144125 |
| Molecular Formula | C23H29F2NO4 |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | [(4aS,10bS)-7-hydroxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(4,4-difluorocyclohexyl)methanone |
| SMILES | O=C(C1CCC(F)(F)CC1)N1CCC2(CC1)Oc1c(O)cccc1[C@H]1OCCC[C@@H]12 |
| InChI | InChI=1S/C23H29F2NO4/c24-23(25)8-6-15(7-9-23)21(28)26-12-10-22(11-13-26)17-4-2-14-29-19(17)16-3-1-5-18(27)20(16)30-22/h1,3,5,15,17,19,27H,2,4,6-14H2/t17-,19+/m0/s1 |
| InChIKey | OVBKQAUWFWLGOF-PKOBYXMFSA-N |
| XLogP | 4.44 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |