C24H31F2NO4 — CID 110144126
[(4aS,10bS)-7-methoxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(4,4-difluorocyclohexyl)methanone (PubChem CID 110144126) has the molecular formula C24H31F2NO4 and a molecular weight of 435.51 g/mol. Its IUPAC name is [(4aS,10bS)-7-methoxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(4,4-difluorocyclohexyl)methanone.
| Compound Name | [(4aS,10bS)-7-methoxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(4,4-difluorocyclohexyl)methanone |
|---|---|
| PubChem CID | 110144126 |
| Molecular Formula | C24H31F2NO4 |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | [(4aS,10bS)-7-methoxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(4,4-difluorocyclohexyl)methanone |
| SMILES | COc1cccc2c1OC1(CCN(C(=O)C3CCC(F)(F)CC3)CC1)[C@H]1CCCO[C@H]21 |
| InChI | InChI=1S/C24H31F2NO4/c1-29-19-6-2-4-17-20-18(5-3-15-30-20)23(31-21(17)19)11-13-27(14-12-23)22(28)16-7-9-24(25,26)10-8-16/h2,4,6,16,18,20H,3,5,7-15H2,1H3/t18-,20+/m0/s1 |
| InChIKey | QJUFIQGFNJCELX-AZUAARDMSA-N |
| XLogP | 4.74 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |