C23H28ClF2NO3 — CID 110144294
[(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(4,4-difluorocyclohexyl)methanone (PubChem CID 110144294) has the molecular formula C23H28ClF2NO3 and a molecular weight of 439.93 g/mol. Its IUPAC name is [(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(4,4-difluorocyclohexyl)methanone.
| Compound Name | [(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(4,4-difluorocyclohexyl)methanone |
|---|---|
| PubChem CID | 110144294 |
| Molecular Formula | C23H28ClF2NO3 |
| Molecular Weight | 439.93 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | [(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(4,4-difluorocyclohexyl)methanone |
| SMILES | O=C(C1CCC(F)(F)CC1)N1CCC2(CC1)Oc1ccc(Cl)cc1[C@H]1OCCC[C@@H]12 |
| InChI | InChI=1S/C23H28ClF2NO3/c24-16-3-4-19-17(14-16)20-18(2-1-13-29-20)22(30-19)9-11-27(12-10-22)21(28)15-5-7-23(25,26)8-6-15/h3-4,14-15,18,20H,1-2,5-13H2/t18-,20+/m0/s1 |
| InChIKey | DHRKNDSJKXPCTE-AZUAARDMSA-N |
| XLogP | 5.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.93 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |