C20H25NO5 — CID 110144734
3-[(2S,4S,4aS,8R,8aR)-4-acetamido-8-hydroxy-4,7-dimethyl-2,3,4a,5,8,8a-hexahydrochromen-2-yl]benzoic acid (PubChem CID 110144734) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is 3-[(2S,4S,4aS,8R,8aR)-4-acetamido-8-hydroxy-4,7-dimethyl-2,3,4a,5,8,8a-hexahydrochromen-2-yl]benzoic acid.
| Compound Name | 3-[(2S,4S,4aS,8R,8aR)-4-acetamido-8-hydroxy-4,7-dimethyl-2,3,4a,5,8,8a-hexahydrochromen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 110144734 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 3-[(2S,4S,4aS,8R,8aR)-4-acetamido-8-hydroxy-4,7-dimethyl-2,3,4a,5,8,8a-hexahydrochromen-2-yl]benzoic acid |
| SMILES | CC(=O)N[C@@]1(C)C[C@@H](c2cccc(C(=O)O)c2)O[C@H]2[C@H](O)C(C)=CC[C@H]21 |
| InChI | InChI=1S/C20H25NO5/c1-11-7-8-15-18(17(11)23)26-16(10-20(15,3)21-12(2)22)13-5-4-6-14(9-13)19(24)25/h4-7,9,15-18,23H,8,10H2,1-3H3,(H,21,22)(H,24,25)/t15-,16+,17-,18-,20+/m1/s1 |
| InChIKey | ADPKYMVYSQDUFO-LYYGHALDSA-N |
| XLogP | 2.44 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|