C34H44FNO5 — CID 110144841
tert-butyl (1S,9R,10S,12S,17S)-6-[(3-fluorophenyl)methoxy]-9-methyl-9-(4-methylpent-3-enyl)-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carboxylate (PubChem CID 110144841) has the molecular formula C34H44FNO5 and a molecular weight of 565.73 g/mol. Its IUPAC name is tert-butyl (1S,9R,10S,12S,17S)-6-[(3-fluorophenyl)methoxy]-9-methyl-9-(4-methylpent-3-enyl)-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carboxylate.
| Compound Name | tert-butyl (1S,9R,10S,12S,17S)-6-[(3-fluorophenyl)methoxy]-9-methyl-9-(4-methylpent-3-enyl)-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carboxylate |
|---|---|
| PubChem CID | 110144841 |
| Molecular Formula | C34H44FNO5 |
| Molecular Weight | 565.73 g/mol |
| Exact Mass | 565.32 |
| IUPAC Name | tert-butyl (1S,9R,10S,12S,17S)-6-[(3-fluorophenyl)methoxy]-9-methyl-9-(4-methylpent-3-enyl)-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carboxylate |
| SMILES | CC(C)=CCC[C@@]1(C)Oc2c(OCc3cccc(F)c3)cccc2[C@H]2O[C@H]3CCN(C(=O)OC(C)(C)C)C[C@@H]3C[C@@H]21 |
| InChI | InChI=1S/C34H44FNO5/c1-22(2)10-9-16-34(6)27-19-24-20-36(32(37)41-33(3,4)5)17-15-28(24)39-30(27)26-13-8-14-29(31(26)40-34)38-21-23-11-7-12-25(35)18-23/h7-8,10-14,18,24,27-28,30H,9,15-17,19-21H2,1-6H3/t24-,27-,28-,30+,34+/m0/s1 |
| InChIKey | KHGUJOUNCMTOGI-PHZFXLFBSA-N |
| XLogP | 8.01 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.73 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|