About (3R,4R)-4-phenoxy-1-(1,3-thiazol-5-ylmethyl)pyrrolidin-3-ol
(3R,4R)-4-phenoxy-1-(1,3-thiazol-5-ylmethyl)pyrrolidin-3-ol (PubChem CID 110145190) has the molecular formula C14H16N2O2S
and a molecular weight of 276.36 g/mol. Its IUPAC name is (3R,4R)-4-phenoxy-1-(1,3-thiazol-5-ylmethyl)pyrrolidin-3-ol.
Molecular Properties
| Compound Name | (3R,4R)-4-phenoxy-1-(1,3-thiazol-5-ylmethyl)pyrrolidin-3-ol |
| PubChem CID | 110145190 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (3R,4R)-4-phenoxy-1-(1,3-thiazol-5-ylmethyl)pyrrolidin-3-ol |
| SMILES | O[C@@H]1CN(Cc2cncs2)C[C@H]1Oc1ccccc1 |
| InChI | InChI=1S/C14H16N2O2S/c17-13-8-16(7-12-6-15-10-19-12)9-14(13)18-11-4-2-1-3-5-11/h1-6,10,13-14,17H,7-9H2/t13-,14-/m1/s1 |
| InChIKey | BGGCNFSPEOLJMM-ZIAGYGMSSA-N |
| XLogP | 1.77 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R,4R)-4-phenoxy-1-(1,3-thiazol-5-ylmethyl)pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-4-phenoxy-1-(1,3-thiazol-5-ylmethyl)pyrrolidin-3-ol?
The IUPAC name of (3R,4R)-4-phenoxy-1-(1,3-thiazol-5-ylmethyl)pyrrolidin-3-ol (CID 110145190) is (3R,4R)-4-phenoxy-1-(1,3-thiazol-5-ylmethyl)pyrrolidin-3-ol.
What is the SMILES notation for (3R,4R)-4-phenoxy-1-(1,3-thiazol-5-ylmethyl)pyrrolidin-3-ol?
The canonical SMILES for (3R,4R)-4-phenoxy-1-(1,3-thiazol-5-ylmethyl)pyrrolidin-3-ol is O[C@@H]1CN(Cc2cncs2)C[C@H]1Oc1ccccc1.
What is the InChIKey of (3R,4R)-4-phenoxy-1-(1,3-thiazol-5-ylmethyl)pyrrolidin-3-ol?
The InChIKey is BGGCNFSPEOLJMM-ZIAGYGMSSA-N. The full InChI is InChI=1S/C14H16N2O2S/c17-13-8-16(7-12-6-15-10-19-12)9-14(13)18-11-4-2-1-3-5-11/h1-6,10,13-14,17H,7-9H2/t13-,14-/m1/s1.
What are the key properties of (3R,4R)-4-phenoxy-1-(1,3-thiazol-5-ylmethyl)pyrrolidin-3-ol?
(3R,4R)-4-phenoxy-1-(1,3-thiazol-5-ylmethyl)pyrrolidin-3-ol has a molecular weight of 276.36 g/mol, XLogP of 1.77, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-4-phenoxy-1-(1,3-thiazol-5-ylmethyl)pyrrolidin-3-ol is sourced from PubChem (CID 110145190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).