C16H16N2O3 — CID 110145191
[(3R,4R)-3-hydroxy-4-phenoxypyrrolidin-1-yl]-pyridin-4-ylmethanone (PubChem CID 110145191) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is [(3R,4R)-3-hydroxy-4-phenoxypyrrolidin-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [(3R,4R)-3-hydroxy-4-phenoxypyrrolidin-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 110145191 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | [(3R,4R)-3-hydroxy-4-phenoxypyrrolidin-1-yl]-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)N1C[C@@H](O)[C@H](Oc2ccccc2)C1 |
| InChI | InChI=1S/C16H16N2O3/c19-14-10-18(16(20)12-6-8-17-9-7-12)11-15(14)21-13-4-2-1-3-5-13/h1-9,14-15,19H,10-11H2/t14-,15-/m1/s1 |
| InChIKey | OHSGOGYVDDINRX-HUUCEWRRSA-N |
| XLogP | 1.35 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |