C23H22N4O2 — CID 11014523
(1R,11S,15R)-8,13-diphenyl-7,8,9,13-tetrazatetracyclo[7.6.0.01,6.011,15]pentadec-6-ene-12,14-dione (PubChem CID 11014523) has the molecular formula C23H22N4O2 and a molecular weight of 386.45 g/mol. Its IUPAC name is (1R,11S,15R)-8,13-diphenyl-7,8,9,13-tetrazatetracyclo[7.6.0.01,6.011,15]pentadec-6-ene-12,14-dione.
| Compound Name | (1R,11S,15R)-8,13-diphenyl-7,8,9,13-tetrazatetracyclo[7.6.0.01,6.011,15]pentadec-6-ene-12,14-dione |
|---|---|
| PubChem CID | 11014523 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (1R,11S,15R)-8,13-diphenyl-7,8,9,13-tetrazatetracyclo[7.6.0.01,6.011,15]pentadec-6-ene-12,14-dione |
| SMILES | O=C1[C@@H]2[C@@H](CN3N(c4ccccc4)N=C4CCCC[C@]423)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C23H22N4O2/c28-21-18-15-25-23(20(18)22(29)26(21)16-9-3-1-4-10-16)14-8-7-13-19(23)24-27(25)17-11-5-2-6-12-17/h1-6,9-12,18,20H,7-8,13-15H2/t18-,20+,23+/m1/s1 |
| InChIKey | FOMVOBSEIQOJKC-RFWXGWTQSA-N |
| XLogP | 3.21 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|