C20H31N7O5 — CID 110145395
tert-butyl N-[4-[[(1R,2R,3R,4R)-4-(6-aminopurin-9-yl)-2,3-dihydroxycyclohexyl]amino]-4-oxobutyl]carbamate (PubChem CID 110145395) has the molecular formula C20H31N7O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is tert-butyl N-[4-[[(1R,2R,3R,4R)-4-(6-aminopurin-9-yl)-2,3-dihydroxycyclohexyl]amino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(1R,2R,3R,4R)-4-(6-aminopurin-9-yl)-2,3-dihydroxycyclohexyl]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 110145395 |
| Molecular Formula | C20H31N7O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | tert-butyl N-[4-[[(1R,2R,3R,4R)-4-(6-aminopurin-9-yl)-2,3-dihydroxycyclohexyl]amino]-4-oxobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)N[C@@H]1CC[C@@H](n2cnc3c(N)ncnc32)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H31N7O5/c1-20(2,3)32-19(31)22-8-4-5-13(28)26-11-6-7-12(16(30)15(11)29)27-10-25-14-17(21)23-9-24-18(14)27/h9-12,15-16,29-30H,4-8H2,1-3H3,(H,22,31)(H,26,28)(H2,21,23,24)/t11-,12-,15-,16-/m1/s1 |
| InChIKey | JOUSIBGTWKYMSK-CZPYZCIJSA-N |
| XLogP | 0.25 |
| TPSA | 177.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|