C23H32N4O3 — CID 110145454
(2R,4aR,10bR)-N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-2,5,5-trimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxamide (PubChem CID 110145454) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is (2R,4aR,10bR)-N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-2,5,5-trimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxamide.
| Compound Name | (2R,4aR,10bR)-N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-2,5,5-trimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxamide |
|---|---|
| PubChem CID | 110145454 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | (2R,4aR,10bR)-N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-2,5,5-trimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxamide |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](O1)c1cc(C(=O)Nc3cnn(CCN(C)C)c3)ccc1OC2(C)C |
| InChI | InChI=1S/C23H32N4O3/c1-15-6-8-19-21(29-15)18-12-16(7-9-20(18)30-23(19,2)3)22(28)25-17-13-24-27(14-17)11-10-26(4)5/h7,9,12-15,19,21H,6,8,10-11H2,1-5H3,(H,25,28)/t15-,19-,21+/m1/s1 |
| InChIKey | PMVDTKUNBORDPY-VMRPVKRXSA-N |
| XLogP | 3.72 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |