C24H27ClFNO2 — CID 110145763
N-[(2S,4S,4aR,7S,8aS)-2-(2-chlorophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-4-fluorobenzamide (PubChem CID 110145763) has the molecular formula C24H27ClFNO2 and a molecular weight of 415.94 g/mol. Its IUPAC name is N-[(2S,4S,4aR,7S,8aS)-2-(2-chlorophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-4-fluorobenzamide.
| Compound Name | N-[(2S,4S,4aR,7S,8aS)-2-(2-chlorophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 110145763 |
| Molecular Formula | C24H27ClFNO2 |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N-[(2S,4S,4aR,7S,8aS)-2-(2-chlorophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-4-fluorobenzamide |
| SMILES | C[C@H]1CC[C@H]2[C@H](C1)O[C@H](c1ccccc1Cl)C[C@]2(C)NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H27ClFNO2/c1-15-7-12-19-21(13-15)29-22(18-5-3-4-6-20(18)25)14-24(19,2)27-23(28)16-8-10-17(26)11-9-16/h3-6,8-11,15,19,21-22H,7,12-14H2,1-2H3,(H,27,28)/t15-,19-,21-,22-,24-/m0/s1 |
| InChIKey | LKOFXAMWCDBOPT-GMQKADSYSA-N |
| XLogP | 5.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |