C15H19FO2 — CID 110145797
(2S,4aS,10bS)-7-fluoro-2,5,5-trimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene (PubChem CID 110145797) has the molecular formula C15H19FO2 and a molecular weight of 250.31 g/mol. Its IUPAC name is (2S,4aS,10bS)-7-fluoro-2,5,5-trimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene.
| Compound Name | (2S,4aS,10bS)-7-fluoro-2,5,5-trimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene |
|---|---|
| PubChem CID | 110145797 |
| Molecular Formula | C15H19FO2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (2S,4aS,10bS)-7-fluoro-2,5,5-trimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene |
| SMILES | C[C@H]1CC[C@H]2[C@H](O1)c1cccc(F)c1OC2(C)C |
| InChI | InChI=1S/C15H19FO2/c1-9-7-8-11-13(17-9)10-5-4-6-12(16)14(10)18-15(11,2)3/h4-6,9,11,13H,7-8H2,1-3H3/t9-,11-,13+/m0/s1 |
| InChIKey | YJWOIWRJFNGUAZ-XHVZSJERSA-N |
| XLogP | 3.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |