C24H30O2 — CID 110146070
(2R,4aS,10bS)-8-tert-butyl-5,5-dimethyl-2-phenyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene (PubChem CID 110146070) has the molecular formula C24H30O2 and a molecular weight of 350.50 g/mol. Its IUPAC name is (2R,4aS,10bS)-8-tert-butyl-5,5-dimethyl-2-phenyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene.
| Compound Name | (2R,4aS,10bS)-8-tert-butyl-5,5-dimethyl-2-phenyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene |
|---|---|
| PubChem CID | 110146070 |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | (2R,4aS,10bS)-8-tert-butyl-5,5-dimethyl-2-phenyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene |
| SMILES | CC(C)(C)c1ccc2c(c1)OC(C)(C)[C@H]1CC[C@H](c3ccccc3)O[C@H]21 |
| InChI | InChI=1S/C24H30O2/c1-23(2,3)17-11-12-18-21(15-17)26-24(4,5)19-13-14-20(25-22(18)19)16-9-7-6-8-10-16/h6-12,15,19-20,22H,13-14H2,1-5H3/t19-,20+,22+/m0/s1 |
| InChIKey | QTAZHVOWOUGIME-TUNNFDKTSA-N |
| XLogP | 6.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |