C22H26O3 — CID 110146077
(2R,4aS,10bS)-5,5-dimethyl-2-(2-phenylethyl)-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-10-ol (PubChem CID 110146077) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is (2R,4aS,10bS)-5,5-dimethyl-2-(2-phenylethyl)-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-10-ol.
| Compound Name | (2R,4aS,10bS)-5,5-dimethyl-2-(2-phenylethyl)-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-10-ol |
|---|---|
| PubChem CID | 110146077 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (2R,4aS,10bS)-5,5-dimethyl-2-(2-phenylethyl)-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-10-ol |
| SMILES | CC1(C)Oc2cccc(O)c2[C@H]2O[C@@H](CCc3ccccc3)CC[C@@H]21 |
| InChI | InChI=1S/C22H26O3/c1-22(2)17-14-13-16(12-11-15-7-4-3-5-8-15)24-21(17)20-18(23)9-6-10-19(20)25-22/h3-10,16-17,21,23H,11-14H2,1-2H3/t16-,17-,21-/m0/s1 |
| InChIKey | UPNIZDHYJPKVBJ-FIKGOQFSSA-N |
| XLogP | 5.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |