C25H28O4 — CID 11014689
(2R,3S)-1,3,4-tris(phenylmethoxy)butan-2-ol (PubChem CID 11014689) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is (2R,3S)-1,3,4-tris(phenylmethoxy)butan-2-ol.
| Compound Name | (2R,3S)-1,3,4-tris(phenylmethoxy)butan-2-ol |
|---|---|
| PubChem CID | 11014689 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (2R,3S)-1,3,4-tris(phenylmethoxy)butan-2-ol |
| SMILES | O[C@H](COCc1ccccc1)[C@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C25H28O4/c26-24(19-27-16-21-10-4-1-5-11-21)25(29-18-23-14-8-3-9-15-23)20-28-17-22-12-6-2-7-13-22/h1-15,24-26H,16-20H2/t24-,25+/m1/s1 |
| InChIKey | WVWVUGTXNHSGNC-RPBOFIJWSA-N |
| XLogP | 4.37 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |