C20H15N3O6 — CID 11014705
(19S)-19-ethyl-19-hydroxy-5-nitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione (PubChem CID 11014705) has the molecular formula C20H15N3O6 and a molecular weight of 393.36 g/mol. Its IUPAC name is (19S)-19-ethyl-19-hydroxy-5-nitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-19-ethyl-19-hydroxy-5-nitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 11014705 |
| Molecular Formula | C20H15N3O6 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (19S)-19-ethyl-19-hydroxy-5-nitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3cccc([N+](=O)[O-])c3nc2-1 |
| InChI | InChI=1S/C20H15N3O6/c1-2-20(26)13-7-15-17-11(8-22(15)18(24)12(13)9-29-19(20)25)6-10-4-3-5-14(23(27)28)16(10)21-17/h3-7,26H,2,8-9H2,1H3/t20-/m0/s1 |
| InChIKey | XQHHKVBMHNTWSH-FQEVSTJZSA-N |
| XLogP | 1.99 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|